NSC 524134
4-Hydroxybenzamide
CAS: 619-57-8
Molecular Formula: C7H7NO2
NSC 524134 - Names and Identifiers
| Name | 4-Hydroxybenzamide |
| Synonyms | AI3-15540 NSC 524134 p-Hydroxybenzamide 4-Hydroxybenzamide P-HYDROXYBENZAMIDE 4-HYDROXYBENZAMIDE Benzamide,p-hydroxy- Benzamide,4-hydroxy- Benzamide, 4-hydroxy- Benzamide, 4-hydroxy- (9CI) 4-HYDROXYBENZAMIDEL DIACETATE 4-HYDROXYBENZAMIDE (P-HYDROXYBENZAMIDE) |
| CAS | 619-57-8 |
| EINECS | 210-602-7 |
| InChI | InChI=1/C7H7NO2/c8-7(10)5-1-3-6(9)4-2-5/h1-4,9H,(H2,8,10) |
NSC 524134 - Physico-chemical Properties
| Molecular Formula | C7H7NO2 |
| Molar Mass | 137.14 |
| Density | 1.286±0.06 g/cm3(Predicted) |
| Melting Point | 161-162 °C (lit.) |
| Boling Point | 345.3±25.0 °C(Predicted) |
| Flash Point | 162.6°C |
| Vapor Presure | 3.12E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow to Dark green |
| BRN | 1906921 |
| pKa | 8.60±0.13(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.612 |
| MDL | MFCD00007997 |
NSC 524134 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Hazard Class | IRRITANT |
NSC 524134 - Introduction
4-Hydroxybenzamide(4-Hydroxybenzamide) is an organic compound with the chemical formula C7H7NO2. Its properties are as follows:
1. Appearance: 4-Hydroxybenzamide is a white crystalline solid or powder.
2. Solubility: It has low solubility in water and is soluble in many organic solvents such as ethanol and esters.
3. Melting Point: The melting point of 4-Hydroxybenzamide is about 180-184 degrees Celsius.
4. Chemical properties: It is a weakly acidic compound that can react with bases to generate salts through protonation reactions.
4-Hydroxybenzamide has several applications in the chemical and pharmaceutical fields. Some common applications include:
1. Chemical intermediate: It can be used as an intermediate for the synthesis of other compounds, such as a starting material for the synthesis of amide compounds and other organic synthesis reactions.
2. Heterocyclic synthesis: It can be used to synthesize heterocyclic compounds containing benzene ring, such as quinoline and pyridine.
A common method of preparing 4-Hydroxybenzamide is through the reaction of p-hydroxybenzoic acid and ammonia. The specific preparation method is as follows:
4-Hydroxybenzamide can be obtained by reacting hydroxybenzoic acid with ammonia in an appropriate solvent. The reaction conditions can be carried out at normal temperature, and the reaction time depends on the specific conditions.
Regarding safety information, due to the acceptable toxicity and safety of 4-Hydroxybenzamide, in normal laboratory and industrial operations, it will not pose a significant safety hazard under correct operation. However, it is still recommended to consult relevant safety data before use and take appropriate safety measures, such as wearing gloves, glasses and appropriate protective clothing to avoid contact with skin or eyes. In addition, proper ventilation conditions need to be observed when handling the compound.
1. Appearance: 4-Hydroxybenzamide is a white crystalline solid or powder.
2. Solubility: It has low solubility in water and is soluble in many organic solvents such as ethanol and esters.
3. Melting Point: The melting point of 4-Hydroxybenzamide is about 180-184 degrees Celsius.
4. Chemical properties: It is a weakly acidic compound that can react with bases to generate salts through protonation reactions.
4-Hydroxybenzamide has several applications in the chemical and pharmaceutical fields. Some common applications include:
1. Chemical intermediate: It can be used as an intermediate for the synthesis of other compounds, such as a starting material for the synthesis of amide compounds and other organic synthesis reactions.
2. Heterocyclic synthesis: It can be used to synthesize heterocyclic compounds containing benzene ring, such as quinoline and pyridine.
A common method of preparing 4-Hydroxybenzamide is through the reaction of p-hydroxybenzoic acid and ammonia. The specific preparation method is as follows:
4-Hydroxybenzamide can be obtained by reacting hydroxybenzoic acid with ammonia in an appropriate solvent. The reaction conditions can be carried out at normal temperature, and the reaction time depends on the specific conditions.
Regarding safety information, due to the acceptable toxicity and safety of 4-Hydroxybenzamide, in normal laboratory and industrial operations, it will not pose a significant safety hazard under correct operation. However, it is still recommended to consult relevant safety data before use and take appropriate safety measures, such as wearing gloves, glasses and appropriate protective clothing to avoid contact with skin or eyes. In addition, proper ventilation conditions need to be observed when handling the compound.
Last Update：2024-04-10 22:29:15
Supplier List
Multiple SpecificationsSpot supply
Product Name: 4-Hydroxybenzamide Visit Supplier Webpage Request for quotationCAS: 619-57-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Multiple SpecificationsSpot supply
Product Name: 4-Hydroxybenzamide Visit Supplier Webpage Request for quotationCAS: 619-57-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History